C10H14O3 — CID 130126797
4,5-dihydroxytricyclo[5.2.1.02,6]decan-8-one (PubChem CID 130126797) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4,5-dihydroxytricyclo[5.2.1.02,6]decan-8-one.
| Compound Name | 4,5-dihydroxytricyclo[5.2.1.02,6]decan-8-one |
|---|---|
| PubChem CID | 130126797 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4,5-dihydroxytricyclo[5.2.1.02,6]decan-8-one |
| SMILES | O=C1CC2CC1C1C(O)C(O)CC21 |
| InChI | InChI=1S/C10H14O3/c11-7-2-4-1-6(7)9-5(4)3-8(12)10(9)13/h4-6,8-10,12-13H,1-3H2 |
| InChIKey | FUJYEKLRTJBUAY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |