About (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one
(1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one (PubChem CID 130966813) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one.
Analyze (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The IUPAC name of (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one (CID 130966813) is (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one.
What is the SMILES notation for (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The canonical SMILES for (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one is O=C1C[C@H]2C[C@H]3[C@@H]1[C@H]3[C@@H]2O.
What is the InChIKey of (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The InChIKey is ZQRLHJNDJFEZJL-AGGUKDSISA-N. The full InChI is InChI=1S/C8H10O2/c9-5-2-3-1-4-6(5)7(4)8(3)10/h3-4,6-8,10H,1-2H2/t3-,4+,6+,7+,8-/m1/s1.
What are the key properties of (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
(1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one has a molecular weight of 138.17 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R,5R,6R,7S)-6-hydroxytricyclo[3.2.1.02,7]octan-3-one is sourced from PubChem (CID 130966813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).