C22H30O2 — CID 90464428
(3aR)-1-[4-[(1R,3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]but-2-ynyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one (PubChem CID 90464428) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (3aR)-1-[4-[(1R,3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]but-2-ynyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one.
| Compound Name | (3aR)-1-[4-[(1R,3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]but-2-ynyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
|---|---|
| PubChem CID | 90464428 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3aR)-1-[4-[(1R,3aR,7aS)-2-oxo-1,3,3a,4,5,6,7,7a-octahydroinden-1-yl]but-2-ynyl]-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
| SMILES | O=C1C[C@H]2CCCCC2C1CC#CC[C@H]1C(=O)C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H30O2/c23-21-13-15-7-1-3-9-17(15)19(21)11-5-6-12-20-18-10-4-2-8-16(18)14-22(20)24/h15-20H,1-4,7-14H2/t15-,16-,17+,18?,19-,20?/m1/s1 |
| InChIKey | UIIWEFFALCEWEG-PBXZBPANSA-N |
| XLogP | 4.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|