C14H24N2O2 — CID 12556899
N-hexyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide (PubChem CID 12556899) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-hexyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-hexyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 12556899 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-hexyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide |
| SMILES | CCCCCCN(C(=O)C(C)C)c1nc(C)co1 |
| InChI | InChI=1S/C14H24N2O2/c1-5-6-7-8-9-16(13(17)11(2)3)14-15-12(4)10-18-14/h10-11H,5-9H2,1-4H3 |
| InChIKey | GJBHVIXTTFEYRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|