C13H13NO6 — CID 12557695
(2-ethoxy-2-oxoethyl) 2-oxo-2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]acetate (PubChem CID 12557695) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-oxo-2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]acetate.
| Compound Name | (2-ethoxy-2-oxoethyl) 2-oxo-2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]acetate |
|---|---|
| PubChem CID | 12557695 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-oxo-2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]acetate |
| SMILES | CCOC(=O)COC(=O)C(=O)Nc1cccccc1=O |
| InChI | InChI=1S/C13H13NO6/c1-2-19-11(16)8-20-13(18)12(17)14-9-6-4-3-5-7-10(9)15/h3-7H,2,8H2,1H3,(H,14,15,17) |
| InChIKey | FCFDXRQGECCBQF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|