C17H15NO5 — CID 12557657
ethyl 2-oxo-2-[(7-oxo-2-phenoxycyclohepta-1,3,5-trien-1-yl)amino]acetate (PubChem CID 12557657) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(7-oxo-2-phenoxycyclohepta-1,3,5-trien-1-yl)amino]acetate.
| Compound Name | ethyl 2-oxo-2-[(7-oxo-2-phenoxycyclohepta-1,3,5-trien-1-yl)amino]acetate |
|---|---|
| PubChem CID | 12557657 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 2-oxo-2-[(7-oxo-2-phenoxycyclohepta-1,3,5-trien-1-yl)amino]acetate |
| SMILES | CCOC(=O)C(=O)Nc1c(Oc2ccccc2)ccccc1=O |
| InChI | InChI=1S/C17H15NO5/c1-2-22-17(21)16(20)18-15-13(19)10-6-7-11-14(15)23-12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,18,19,20) |
| InChIKey | PRILLBAAWKJYAQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|