C16H12INO5 — CID 54513230
methyl 2-[(4-iodo-3-oxo-7-phenoxycyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate (PubChem CID 54513230) has the molecular formula C16H12INO5 and a molecular weight of 425.18 g/mol. Its IUPAC name is methyl 2-[(4-iodo-3-oxo-7-phenoxycyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(4-iodo-3-oxo-7-phenoxycyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 54513230 |
| Molecular Formula | C16H12INO5 |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | methyl 2-[(4-iodo-3-oxo-7-phenoxycyclohepta-1,4,6-trien-1-yl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(=O)c(I)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C16H12INO5/c1-22-16(21)15(20)18-12-9-13(19)11(17)7-8-14(12)23-10-5-3-2-4-6-10/h2-9H,1H3,(H,18,20) |
| InChIKey | YKPNDTHXDJKXPS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|