C24H24N2O5S — CID 26881544
4-methoxy-N-(2-phenoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26881544) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is 4-methoxy-N-(2-phenoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-methoxy-N-(2-phenoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26881544 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-methoxy-N-(2-phenoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2Oc2ccccc2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C24H24N2O5S/c1-30-22-14-13-18(17-23(22)32(28,29)26-15-7-8-16-26)24(27)25-20-11-5-6-12-21(20)31-19-9-3-2-4-10-19/h2-6,9-14,17H,7-8,15-16H2,1H3,(H,25,27) |
| InChIKey | ZVGFNWILJCQYTQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |