C20H25N3O6S2 — CID 55985107
N-[2-(dimethylsulfamoyl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55985107) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55985107 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2S(=O)(=O)N(C)C)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H25N3O6S2/c1-22(2)30(25,26)18-9-5-4-8-16(18)21-20(24)15-10-11-17(29-3)19(14-15)31(27,28)23-12-6-7-13-23/h4-5,8-11,14H,6-7,12-13H2,1-3H3,(H,21,24) |
| InChIKey | PIBSGMQEBMMSNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |