C26H27N3O4S — CID 38749018
N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 38749018) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 38749018 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2N2CCc3ccccc32)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C26H27N3O4S/c1-33-24-13-12-20(18-25(24)34(31,32)28-15-6-7-16-28)26(30)27-21-9-3-5-11-23(21)29-17-14-19-8-2-4-10-22(19)29/h2-5,8-13,18H,6-7,14-17H2,1H3,(H,27,30) |
| InChIKey | RWXCSFFRVIRCKM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |