C16H24O4 — CID 12558936
ethyl (2E)-2-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methylidene]-3-oxobutanoate (PubChem CID 12558936) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl (2E)-2-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methylidene]-3-oxobutanoate.
| Compound Name | ethyl (2E)-2-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 12558936 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl (2E)-2-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methylidene]-3-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/C1OC1(C)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C16H24O4/c1-6-19-15(18)13(12(4)17)10-14-16(5,20-14)9-7-8-11(2)3/h8,10,14H,6-7,9H2,1-5H3/b13-10+ |
| InChIKey | LVHXGEZUBBPILW-JLHYYAGUSA-N |
| XLogP | 2.97 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|