C19H28O2 — CID 138404381
1-[(2E,6Z,10E)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-3-yl]ethanone (PubChem CID 138404381) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-[(2E,6Z,10E)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-3-yl]ethanone.
| Compound Name | 1-[(2E,6Z,10E)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-3-yl]ethanone |
|---|---|
| PubChem CID | 138404381 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-[(2E,6Z,10E)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-3-yl]ethanone |
| SMILES | CC(=O)/C1=C/C2OC2(C)CC/C=C(\C)CC/C=C(/C)CC1 |
| InChI | InChI=1S/C19H28O2/c1-14-7-5-8-15(2)10-11-17(16(3)20)13-18-19(4,21-18)12-6-9-14/h8-9,13,18H,5-7,10-12H2,1-4H3/b14-9+,15-8-,17-13+ |
| InChIKey | OOUAMFIGDJHZPY-LQKLJAAOSA-N |
| XLogP | 4.91 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|