About (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine
(1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine (PubChem CID 12564946) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine.
Analyze (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine?
The IUPAC name of (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine (CID 12564946) is (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine.
What is the SMILES notation for (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine?
The canonical SMILES for (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine is C[C@@H](C1=CC=CC1)N(C)C.
What is the InChIKey of (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine?
The InChIKey is RZRJXBMDSQLCHX-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15N/c1-8(10(2)3)9-6-4-5-7-9/h4-6,8H,7H2,1-3H3/t8-/m0/s1.
What are the key properties of (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine?
(1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine has a molecular weight of 137.23 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine is sourced from PubChem (CID 12564946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).