C14H21FeN — CID 12564947
cyclopenta-1,3-diene;(1R)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine;iron (PubChem CID 12564947) has the molecular formula C14H21FeN and a molecular weight of 259.17 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(1R)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine;iron.
| Compound Name | cyclopenta-1,3-diene;(1R)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine;iron |
|---|---|
| PubChem CID | 12564947 |
| Molecular Formula | C14H21FeN |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | cyclopenta-1,3-diene;(1R)-1-cyclopenta-1,3-dien-1-yl-N,N-dimethylethanamine;iron |
| SMILES | C1=CCC=C1.C[C@H](C1=CC=CC1)N(C)C.[Fe] |
| InChI | InChI=1S/C9H15N.C5H6.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-6,8H,7H2,1-3H3;1-4H,5H2;/t8-;;/m1../s1 |
| InChIKey | FPGWTEWNRFGHLI-YCBDHFTFSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|