C17H16ClN3O — CID 12569802
8-chloro-1-hydroxy-4-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-imine (PubChem CID 12569802) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 8-chloro-1-hydroxy-4-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-imine.
| Compound Name | 8-chloro-1-hydroxy-4-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-imine |
|---|---|
| PubChem CID | 12569802 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 8-chloro-1-hydroxy-4-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-imine |
| SMILES | [H]/N=C1\CC(C)/N=C(/c2ccccc2)c2cc(Cl)ccc2N1O |
| InChI | InChI=1S/C17H16ClN3O/c1-11-9-16(19)21(22)15-8-7-13(18)10-14(15)17(20-11)12-5-3-2-4-6-12/h2-8,10-11,19,22H,9H2,1H3/b19-16+,20-17- |
| InChIKey | VTMVYVMDHRMGKB-YZXPOQMXSA-N |
| XLogP | 4.14 |
| TPSA | 59.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|