About 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one
4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one (PubChem CID 12570199) has the molecular formula C18H16O4S
and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one.
Molecular Properties
| Compound Name | 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one |
| PubChem CID | 12570199 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one |
| SMILES | CCOC1=C(c2ccccc2)S(=O)(=O)C(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16O4S/c1-2-22-16-15(19)17(13-9-5-3-6-10-13)23(20,21)18(16)14-11-7-4-8-12-14/h3-12,17H,2H2,1H3 |
| InChIKey | SDXIQKVAKXQBKQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one?
The IUPAC name of 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one (CID 12570199) is 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one.
What is the SMILES notation for 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one?
The canonical SMILES for 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one is CCOC1=C(c2ccccc2)S(=O)(=O)C(c2ccccc2)C1=O.
What is the InChIKey of 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one?
The InChIKey is SDXIQKVAKXQBKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O4S/c1-2-22-16-15(19)17(13-9-5-3-6-10-13)23(20,21)18(16)14-11-7-4-8-12-14/h3-12,17H,2H2,1H3.
What are the key properties of 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one?
4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one has a molecular weight of 328.39 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-1,1-dioxo-2,5-diphenylthiophen-3-one is sourced from PubChem (CID 12570199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).