C13H14O4S — CID 593960
3-ethoxy-1,1-dioxo-2-phenyl-2H-thiopyran-5-one (PubChem CID 593960) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-ethoxy-1,1-dioxo-2-phenyl-2H-thiopyran-5-one.
| Compound Name | 3-ethoxy-1,1-dioxo-2-phenyl-2H-thiopyran-5-one |
|---|---|
| PubChem CID | 593960 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-ethoxy-1,1-dioxo-2-phenyl-2H-thiopyran-5-one |
| SMILES | CCOC1=CC(=O)CS(=O)(=O)C1c1ccccc1 |
| InChI | InChI=1S/C13H14O4S/c1-2-17-12-8-11(14)9-18(15,16)13(12)10-6-4-3-5-7-10/h3-8,13H,2,9H2,1H3 |
| InChIKey | SPNHECWEUICPTQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |