C13H17NO — CID 12580580
4-phenyl-2-propan-2-yl-3,6-dihydrooxazine (PubChem CID 12580580) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-phenyl-2-propan-2-yl-3,6-dihydrooxazine.
| Compound Name | 4-phenyl-2-propan-2-yl-3,6-dihydrooxazine |
|---|---|
| PubChem CID | 12580580 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-phenyl-2-propan-2-yl-3,6-dihydrooxazine |
| SMILES | CC(C)N1CC(c2ccccc2)=CCO1 |
| InChI | InChI=1S/C13H17NO/c1-11(2)14-10-13(8-9-15-14)12-6-4-3-5-7-12/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | KZXMOJNFCFDETE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |