About 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine
5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine (PubChem CID 12581463) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine.
Analyze 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine?
The IUPAC name of 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine (CID 12581463) is 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine.
What is the SMILES notation for 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine?
The canonical SMILES for 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine is CCC1=CN(C)CCC1N(C)C.
What is the InChIKey of 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine?
The InChIKey is CYTIZUHFZZUGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-9-8-12(4)7-6-10(9)11(2)3/h8,10H,5-7H2,1-4H3.
What are the key properties of 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine?
5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine has a molecular weight of 168.28 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,N,1-trimethyl-3,4-dihydro-2H-pyridin-4-amine is sourced from PubChem (CID 12581463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).