C23H17BrO4 — CID 12582111
[2-(2-bromo-3-oxo-2,3-diphenylpropanoyl)phenyl] acetate (PubChem CID 12582111) has the molecular formula C23H17BrO4 and a molecular weight of 437.29 g/mol. Its IUPAC name is [2-(2-bromo-3-oxo-2,3-diphenylpropanoyl)phenyl] acetate.
| Compound Name | [2-(2-bromo-3-oxo-2,3-diphenylpropanoyl)phenyl] acetate |
|---|---|
| PubChem CID | 12582111 |
| Molecular Formula | C23H17BrO4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [2-(2-bromo-3-oxo-2,3-diphenylpropanoyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)C(Br)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17BrO4/c1-16(25)28-20-15-9-8-14-19(20)22(27)23(24,18-12-6-3-7-13-18)21(26)17-10-4-2-5-11-17/h2-15H,1H3 |
| InChIKey | XZESJFMGUOUDRH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|