C27H29NO2 — CID 12582237
1-[2-acetyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]ethanone (PubChem CID 12582237) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-[2-acetyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]ethanone.
| Compound Name | 1-[2-acetyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]ethanone |
|---|---|
| PubChem CID | 12582237 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[2-acetyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]ethanone |
| SMILES | CCN(CC)c1c(C)c(-c2ccccc2)c(-c2ccccc2)c(C(C)=O)c1C(C)=O |
| InChI | InChI=1S/C27H29NO2/c1-6-28(7-2)27-18(3)23(21-14-10-8-11-15-21)26(22-16-12-9-13-17-22)24(19(4)29)25(27)20(5)30/h8-17H,6-7H2,1-5H3 |
| InChIKey | SKYGRGJIGLROFB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |