C37H33NO2 — CID 12582238
[2-benzoyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]-phenylmethanone (PubChem CID 12582238) has the molecular formula C37H33NO2 and a molecular weight of 523.68 g/mol. Its IUPAC name is [2-benzoyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]-phenylmethanone.
| Compound Name | [2-benzoyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 12582238 |
| Molecular Formula | C37H33NO2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | [2-benzoyl-3-(diethylamino)-4-methyl-5,6-diphenylphenyl]-phenylmethanone |
| SMILES | CCN(CC)c1c(C)c(-c2ccccc2)c(-c2ccccc2)c(C(=O)c2ccccc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H33NO2/c1-4-38(5-2)35-26(3)31(27-18-10-6-11-19-27)32(28-20-12-7-13-21-28)33(36(39)29-22-14-8-15-23-29)34(35)37(40)30-24-16-9-17-25-30/h6-25H,4-5H2,1-3H3 |
| InChIKey | QMFUZCQXUCXSCO-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |