C21H15BrF3N3O6S — CID 1258561
3-[4-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonyl-N-(5-bromo-2-hydroxyphenyl)propanamide (PubChem CID 1258561) has the molecular formula C21H15BrF3N3O6S and a molecular weight of 574.33 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonyl-N-(5-bromo-2-hydroxyphenyl)propanamide.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonyl-N-(5-bromo-2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 1258561 |
| Molecular Formula | C21H15BrF3N3O6S |
| Molecular Weight | 574.33 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonyl-N-(5-bromo-2-hydroxyphenyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1nc(-c2ccc3c(c2)OCO3)cc(C(F)(F)F)n1)Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C21H15BrF3N3O6S/c22-12-2-3-15(29)14(8-12)26-19(30)5-6-35(31,32)20-27-13(9-18(28-20)21(23,24)25)11-1-4-16-17(7-11)34-10-33-16/h1-4,7-9,29H,5-6,10H2,(H,26,30) |
| InChIKey | KPTKMPYAGQOAMC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|