C25H22F3N3O7S — CID 5080782
[1-(1,3-benzodioxol-5-yl)ethenylamino] 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylbutanoate (PubChem CID 5080782) has the molecular formula C25H22F3N3O7S and a molecular weight of 565.53 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)ethenylamino] 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylbutanoate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)ethenylamino] 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylbutanoate |
|---|---|
| PubChem CID | 5080782 |
| Molecular Formula | C25H22F3N3O7S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)ethenylamino] 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylbutanoate |
| SMILES | C=C(NOC(=O)CCCS(=O)(=O)c1nc(-c2ccccc2OC)cc(C(F)(F)F)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22F3N3O7S/c1-15(16-9-10-20-21(12-16)37-14-36-20)31-38-23(32)8-5-11-39(33,34)24-29-18(13-22(30-24)25(26,27)28)17-6-3-4-7-19(17)35-2/h3-4,6-7,9-10,12-13,31H,1,5,8,11,14H2,2H3 |
| InChIKey | IBGPQYSZDZPFPJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|