C13H25O4P — CID 12591886
2-dipropoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene (PubChem CID 12591886) has the molecular formula C13H25O4P and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-dipropoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene.
| Compound Name | 2-dipropoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 12591886 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-dipropoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene |
| SMILES | C=C(C(OC)=C(C)C)P(=O)(OCCC)OCCC |
| InChI | InChI=1S/C13H25O4P/c1-7-9-16-18(14,17-10-8-2)12(5)13(15-6)11(3)4/h5,7-10H2,1-4,6H3 |
| InChIKey | ZUTTXUQWEHXSOF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|