C9F20O — CID 12596614
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)pentane (PubChem CID 12596614) has the molecular formula C9F20O and a molecular weight of 504.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)pentane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)pentane |
|---|---|
| PubChem CID | 12596614 |
| Molecular Formula | C9F20O |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)pentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F20O/c10-1(11,2(12,13)6(20,21)22)4(16,17)8(26,27)30-9(28,29)5(18,19)3(14,15)7(23,24)25 |
| InChIKey | PKICSMGULRSLJG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|