C22H26N4 — CID 126001450
N-[(E)-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2,4-dimethylaniline (PubChem CID 126001450) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[(E)-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2,4-dimethylaniline.
| Compound Name | N-[(E)-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 126001450 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | N-[(E)-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2,4-dimethylaniline |
| SMILES | Cc1ccc(N/N=C/c2c(C)nn(-c3ccc(C)c(C)c3)c2C)c(C)c1 |
| InChI | InChI=1S/C22H26N4/c1-14-7-10-22(17(4)11-14)24-23-13-21-18(5)25-26(19(21)6)20-9-8-15(2)16(3)12-20/h7-13,24H,1-6H3/b23-13+ |
| InChIKey | JPVWYIKBORHVHQ-YDZHTSKRSA-N |
| XLogP | 5.17 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|