C27H20I2N2O5S — CID 126009875
4-[[4-[(E)-[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126009875) has the molecular formula C27H20I2N2O5S and a molecular weight of 738.34 g/mol. Its IUPAC name is 4-[[4-[(E)-[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126009875 |
| Molecular Formula | C27H20I2N2O5S |
| Molecular Weight | 738.34 g/mol |
| Exact Mass | 737.92 |
| IUPAC Name | 4-[[4-[(E)-[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | Cc1cccc(N2C(=O)/C(=C/c3cc(I)c(OCc4ccc(C(=O)O)cc4)c(I)c3)C(=O)NC2=S)c1C |
| InChI | InChI=1S/C27H20I2N2O5S/c1-14-4-3-5-22(15(14)2)31-25(33)19(24(32)30-27(31)37)10-17-11-20(28)23(21(29)12-17)36-13-16-6-8-18(9-7-16)26(34)35/h3-12H,13H2,1-2H3,(H,34,35)(H,30,32,37)/b19-10+ |
| InChIKey | YYLSSBHCEJGHDX-VXLYETTFSA-N |
| XLogP | 5.62 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|