C25H14Cl2I2N2O5S — CID 126007620
4-[[4-[(E)-[1-(3,4-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126007620) has the molecular formula C25H14Cl2I2N2O5S and a molecular weight of 779.18 g/mol. Its IUPAC name is 4-[[4-[(E)-[1-(3,4-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[1-(3,4-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126007620 |
| Molecular Formula | C25H14Cl2I2N2O5S |
| Molecular Weight | 779.18 g/mol |
| Exact Mass | 777.81 |
| IUPAC Name | 4-[[4-[(E)-[1-(3,4-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C/c1cc(I)c(OCc2ccc(C(=O)O)cc2)c(I)c1 |
| InChI | InChI=1S/C25H14Cl2I2N2O5S/c26-17-6-5-15(10-18(17)27)31-23(33)16(22(32)30-25(31)37)7-13-8-19(28)21(20(29)9-13)36-11-12-1-3-14(4-2-12)24(34)35/h1-10H,11H2,(H,34,35)(H,30,32,37)/b16-7+ |
| InChIKey | OKOMVMVOQWSLKT-FRKPEAEDSA-N |
| XLogP | 6.31 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.18 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|