C19H16ClFN4O4 — CID 126013955
(E)-3-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 126013955) has the molecular formula C19H16ClFN4O4 and a molecular weight of 418.81 g/mol. Its IUPAC name is (E)-3-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126013955 |
| Molecular Formula | C19H16ClFN4O4 |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-3-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)N2CCOCC2)cc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C19H16ClFN4O4/c1-27-15-3-2-12(8-13(10-22)18(26)25-4-6-28-7-5-25)9-16(15)29-17-14(21)11-23-19(20)24-17/h2-3,8-9,11H,4-7H2,1H3/b13-8+ |
| InChIKey | OBOUUKXVYPWEFN-MDWZMJQESA-N |
| XLogP | 2.84 |
| TPSA | 97.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|