C15H10ClFN4O3 — CID 4610199
3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-methoxyphenyl]-2-cyanoprop-2-enamide (PubChem CID 4610199) has the molecular formula C15H10ClFN4O3 and a molecular weight of 348.72 g/mol. Its IUPAC name is 3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-methoxyphenyl]-2-cyanoprop-2-enamide.
| Compound Name | 3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-methoxyphenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4610199 |
| Molecular Formula | C15H10ClFN4O3 |
| Molecular Weight | 348.72 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-methoxyphenyl]-2-cyanoprop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(N)=O)ccc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C15H10ClFN4O3/c1-23-12-5-8(4-9(6-18)13(19)22)2-3-11(12)24-14-10(17)7-20-15(16)21-14/h2-5,7H,1H3,(H2,19,22) |
| InChIKey | BIORZRUGSCUZCF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|