C25H17ClFN3O2 — CID 126324966
(E)-3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]-2-naphthalen-1-ylprop-2-enenitrile (PubChem CID 126324966) has the molecular formula C25H17ClFN3O2 and a molecular weight of 445.88 g/mol. Its IUPAC name is (E)-3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]-2-naphthalen-1-ylprop-2-enenitrile.
| Compound Name | (E)-3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]-2-naphthalen-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 126324966 |
| Molecular Formula | C25H17ClFN3O2 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (E)-3-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]-2-naphthalen-1-ylprop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2cccc3ccccc23)ccc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C25H17ClFN3O2/c1-2-31-23-13-16(10-11-22(23)32-24-21(27)15-29-25(26)30-24)12-18(14-28)20-9-5-7-17-6-3-4-8-19(17)20/h3-13,15H,2H2,1H3/b18-12- |
| InChIKey | ZVQCHARVTVWQJH-PDGQHHTCSA-N |
| XLogP | 6.68 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|