C23H18BrN3O3S — CID 126019774
3-[[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-methylbenzoic acid (PubChem CID 126019774) has the molecular formula C23H18BrN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-methylbenzoic acid.
| Compound Name | 3-[[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 126019774 |
| Molecular Formula | C23H18BrN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 3-[[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-methylbenzoic acid |
| SMILES | Cc1c(/N=C2/S/C(=C\c3cccn3-c3cccc(Br)c3)C(=O)N2C)cccc1C(=O)O |
| InChI | InChI=1S/C23H18BrN3O3S/c1-14-18(22(29)30)9-4-10-19(14)25-23-26(2)21(28)20(31-23)13-17-8-5-11-27(17)16-7-3-6-15(24)12-16/h3-13H,1-2H3,(H,29,30)/b20-13-,25-23+ |
| InChIKey | MBTMAKVZLLLREP-DMDNQVQLSA-N |
| XLogP | 5.48 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|