C14H13N5O6 — CID 126023544
ethyl 2-[(3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetate (PubChem CID 126023544) has the molecular formula C14H13N5O6 and a molecular weight of 347.29 g/mol. Its IUPAC name is ethyl 2-[(3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetate.
| Compound Name | ethyl 2-[(3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetate |
|---|---|
| PubChem CID | 126023544 |
| Molecular Formula | C14H13N5O6 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 2-[(3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetate |
| SMILES | CCOC(=O)CN1N=N[C@@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C14H13N5O6/c1-2-25-10(20)7-17-12-11(15-16-17)13(21)18(14(12)22)8-3-5-9(6-4-8)19(23)24/h3-6,11-12H,2,7H2,1H3/t11-,12+/m0/s1 |
| InChIKey | MGGFFBPBDIFPJB-NWDGAFQWSA-N |
| XLogP | 0.45 |
| TPSA | 134.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|