C22H22N4O2 — CID 126025717
N-[(E)-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]amino]-2-quinolin-8-yloxyacetamide (PubChem CID 126025717) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(E)-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]amino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(E)-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]amino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 126025717 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[(E)-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]amino]-2-quinolin-8-yloxyacetamide |
| SMILES | CN(C)c1ccc(/C=C/C=N/NC(=O)COc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-26(2)19-12-10-17(11-13-19)6-4-15-24-25-21(27)16-28-20-9-3-7-18-8-5-14-23-22(18)20/h3-15H,16H2,1-2H3,(H,25,27)/b6-4+,24-15+ |
| InChIKey | YPYABPYUDCBIAK-DAJJOZHVSA-N |
| XLogP | 3.49 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|