C27H28N2O2S2 — CID 126034362
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 126034362) has the molecular formula C27H28N2O2S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 126034362 |
| Molecular Formula | C27H28N2O2S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | Cc1ccccc1CSCCNC(=O)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O2S2/c1-20-7-5-6-10-24(20)18-32-16-15-28-26(31)22-11-13-23(14-12-22)27-29(25(30)19-33-27)17-21-8-3-2-4-9-21/h2-14,27H,15-19H2,1H3,(H,28,31)/t27-/m1/s1 |
| InChIKey | GJBYLSYUKFEEEO-HHHXNRCGSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|