C23H21ClO3 — CID 12604000
(5-benzylfuran-3-yl)methyl 2-(4-chlorophenyl)-2-cyclopropylacetate (PubChem CID 12604000) has the molecular formula C23H21ClO3 and a molecular weight of 380.87 g/mol. Its IUPAC name is (5-benzylfuran-3-yl)methyl 2-(4-chlorophenyl)-2-cyclopropylacetate.
| Compound Name | (5-benzylfuran-3-yl)methyl 2-(4-chlorophenyl)-2-cyclopropylacetate |
|---|---|
| PubChem CID | 12604000 |
| Molecular Formula | C23H21ClO3 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (5-benzylfuran-3-yl)methyl 2-(4-chlorophenyl)-2-cyclopropylacetate |
| SMILES | O=C(OCc1coc(Cc2ccccc2)c1)C(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C23H21ClO3/c24-20-10-8-19(9-11-20)22(18-6-7-18)23(25)27-15-17-13-21(26-14-17)12-16-4-2-1-3-5-16/h1-5,8-11,13-14,18,22H,6-7,12,15H2 |
| InChIKey | JMPMHYAYPPCBJE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |