C19H15FN4O2S — CID 126059557
N-[(Z)-[(E)-4-(2-fluorophenyl)but-3-en-2-ylidene]amino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 126059557) has the molecular formula C19H15FN4O2S and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[(Z)-[(E)-4-(2-fluorophenyl)but-3-en-2-ylidene]amino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[(E)-4-(2-fluorophenyl)but-3-en-2-ylidene]amino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 126059557 |
| Molecular Formula | C19H15FN4O2S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(Z)-[(E)-4-(2-fluorophenyl)but-3-en-2-ylidene]amino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | CC(/C=C/c1ccccc1F)=N/Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C19H15FN4O2S/c1-13(9-10-14-5-2-3-8-17(14)20)22-23-19-21-18(12-27-19)15-6-4-7-16(11-15)24(25)26/h2-12H,1H3,(H,21,23)/b10-9+,22-13- |
| InChIKey | LJHMEUKJXZLZON-HQHQWOAWSA-N |
| XLogP | 5.36 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|