C26H26N3O2+ — CID 126062138
N-[(1Z,4R,5R)-3-oxo-5-phenyl-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126062138) has the molecular formula C26H26N3O2+ and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[(1Z,4R,5R)-3-oxo-5-phenyl-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | N-[(1Z,4R,5R)-3-oxo-5-phenyl-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126062138 |
| Molecular Formula | C26H26N3O2+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[(1Z,4R,5R)-3-oxo-5-phenyl-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide |
| SMILES | CC(C)c1ccc(/C=[N+]2\NC(=O)[C@H](NC(=O)c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-18(2)20-15-13-19(14-16-20)17-29-24(21-9-5-3-6-10-21)23(26(31)28-29)27-25(30)22-11-7-4-8-12-22/h3-18,23-24H,1-2H3,(H-,27,28,30,31)/p+1/b29-17-/t23-,24-/m1/s1 |
| InChIKey | ATQOFSOQRAXPLR-OLMNJFBISA-O |
| XLogP | 3.83 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|