C29H30IN3O2 — CID 126069619
(E)-2-cyano-3-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 126069619) has the molecular formula C29H30IN3O2 and a molecular weight of 579.48 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126069619 |
| Molecular Formula | C29H30IN3O2 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | (E)-2-cyano-3-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)c(OCc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C29H30IN3O2/c1-5-33(6-2)26-13-10-23(28(17-26)35-19-22-8-11-25(30)12-9-22)16-24(18-31)29(34)32-27-14-7-20(3)15-21(27)4/h7-17H,5-6,19H2,1-4H3,(H,32,34)/b24-16+ |
| InChIKey | JGAHZNVNLBYULK-LFVJCYFKSA-N |
| XLogP | 6.88 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|