C9H15N — CID 12607506
3,4-dimethylidene-1-propan-2-ylpyrrolidine (PubChem CID 12607506) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3,4-dimethylidene-1-propan-2-ylpyrrolidine.
| Compound Name | 3,4-dimethylidene-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 12607506 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3,4-dimethylidene-1-propan-2-ylpyrrolidine |
| SMILES | C=C1CN(C(C)C)CC1=C |
| InChI | InChI=1S/C9H15N/c1-7(2)10-5-8(3)9(4)6-10/h7H,3-6H2,1-2H3 |
| InChIKey | QMXRRXVNSZIYFA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |