C26H28IN3S — CID 126088556
(6S)-6-tert-butyl-2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126088556) has the molecular formula C26H28IN3S and a molecular weight of 541.50 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126088556 |
| Molecular Formula | C26H28IN3S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1cc(C=Nc2sc3c(c2C#N)CC[C@H](C(C)(C)C)C3)c(C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C26H28IN3S/c1-16-12-18(17(2)30(16)21-9-7-20(27)8-10-21)15-29-25-23(14-28)22-11-6-19(26(3,4)5)13-24(22)31-25/h7-10,12,15,19H,6,11,13H2,1-5H3/t19-/m0/s1 |
| InChIKey | ROECQYZBOHTKSK-IBGZPJMESA-N |
| XLogP | 7.53 |
| TPSA | 41.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|