C29H27N3O4S — CID 126113282
5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126113282) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126113282 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1C=C1C(=O)N(c2ccccc2)C(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C29H27N3O4S/c1-35-25-19-24(30-15-9-10-16-30)26(36-2)18-20(25)17-23-27(33)31(21-11-5-3-6-12-21)29(37)32(28(23)34)22-13-7-4-8-14-22/h3-8,11-14,17-19H,9-10,15-16H2,1-2H3 |
| InChIKey | NOMVMSSUXZSXMZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|