C23H22FN3O5 — CID 126098254
(5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126098254) has the molecular formula C23H22FN3O5 and a molecular weight of 439.44 g/mol. Its IUPAC name is (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126098254 |
| Molecular Formula | C23H22FN3O5 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=C1\C(=O)NC(=O)N(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C23H22FN3O5/c1-31-19-13-18(26-8-3-4-9-26)20(32-2)11-14(19)10-17-21(28)25-23(30)27(22(17)29)16-7-5-6-15(24)12-16/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,25,28,30)/b17-10+ |
| InChIKey | VPHDIVGDRPSSPI-LICLKQGHSA-N |
| XLogP | 3.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|