C25H27N3O4S — CID 126107747
(5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126107747) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126107747 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (5E)-5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(OC)c(N4CCCC4)cc3OC)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C25H27N3O4S/c1-4-16-7-9-18(10-8-16)28-24(30)19(23(29)26-25(28)33)13-17-14-22(32-3)20(15-21(17)31-2)27-11-5-6-12-27/h7-10,13-15H,4-6,11-12H2,1-3H3,(H,26,29,33)/b19-13+ |
| InChIKey | YCPRFOBACYXFHO-CPNJWEJPSA-N |
| XLogP | 3.70 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|