C19H21N3OS — CID 126128169
4-(3,4-dimethylphenyl)-3-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazole (PubChem CID 126128169) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-3-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazole.
| Compound Name | 4-(3,4-dimethylphenyl)-3-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 126128169 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-3-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-n2c(C)nnc2SCCOc2ccccc2)cc1C |
| InChI | InChI=1S/C19H21N3OS/c1-14-9-10-17(13-15(14)2)22-16(3)20-21-19(22)24-12-11-23-18-7-5-4-6-8-18/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | YLGJJDRVVSULNB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|