C18H19Cl2N3O3S — CID 126166508
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 126166508) has the molecular formula C18H19Cl2N3O3S and a molecular weight of 428.34 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126166508 |
| Molecular Formula | C18H19Cl2N3O3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC(=O)N/N=C\c2c(Cl)cccc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H19Cl2N3O3S/c1-11-7-12(2)18(13(3)8-11)27(25,26)22-10-17(24)23-21-9-14-15(19)5-4-6-16(14)20/h4-9,22H,10H2,1-3H3,(H,23,24)/b21-9- |
| InChIKey | FBASTVZVGDUDOA-NKVSQWTQSA-N |
| XLogP | 3.35 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|