C23H20F12O2Se — CID 12616921
1,1-bis[(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxy]-3,3-dimethyl-1λ4-selenetane (PubChem CID 12616921) has the molecular formula C23H20F12O2Se and a molecular weight of 635.35 g/mol. Its IUPAC name is 1,1-bis[(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxy]-3,3-dimethyl-1λ4-selenetane.
| Compound Name | 1,1-bis[(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxy]-3,3-dimethyl-1λ4-selenetane |
|---|---|
| PubChem CID | 12616921 |
| Molecular Formula | C23H20F12O2Se |
| Molecular Weight | 635.35 g/mol |
| Exact Mass | 636.04 |
| IUPAC Name | 1,1-bis[(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxy]-3,3-dimethyl-1λ4-selenetane |
| SMILES | CC1(C)C[Se](OC(c2ccccc2)(C(F)(F)F)C(F)(F)F)(OC(c2ccccc2)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C23H20F12O2Se/c1-17(2)13-38(14-17,36-18(20(24,25)26,21(27,28)29)15-9-5-3-6-10-15)37-19(22(30,31)32,23(33,34)35)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | ALAWVJBOEJXOEP-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.35 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|