C15H19NO — CID 126187380
(2Z,6S)-2-[(benzylamino)methylidene]-6-methylcyclohexan-1-one (PubChem CID 126187380) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2Z,6S)-2-[(benzylamino)methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2Z,6S)-2-[(benzylamino)methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 126187380 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2Z,6S)-2-[(benzylamino)methylidene]-6-methylcyclohexan-1-one |
| SMILES | C[C@H]1CCC/C(=C/NCc2ccccc2)C1=O |
| InChI | InChI=1S/C15H19NO/c1-12-6-5-9-14(15(12)17)11-16-10-13-7-3-2-4-8-13/h2-4,7-8,11-12,16H,5-6,9-10H2,1H3/b14-11-/t12-/m0/s1 |
| InChIKey | WRVGVDDCLGQAHP-PBBNAPBQSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|