C17H16ClNOS2 — CID 12619952
(NE)-N-[(2-chlorophenyl)-(2-phenyl-1,3-dithian-2-yl)methylidene]hydroxylamine (PubChem CID 12619952) has the molecular formula C17H16ClNOS2 and a molecular weight of 349.91 g/mol. Its IUPAC name is (NE)-N-[(2-chlorophenyl)-(2-phenyl-1,3-dithian-2-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2-chlorophenyl)-(2-phenyl-1,3-dithian-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 12619952 |
| Molecular Formula | C17H16ClNOS2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | (NE)-N-[(2-chlorophenyl)-(2-phenyl-1,3-dithian-2-yl)methylidene]hydroxylamine |
| SMILES | O/N=C(\c1ccccc1Cl)C1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C17H16ClNOS2/c18-15-10-5-4-9-14(15)16(19-20)17(21-11-6-12-22-17)13-7-2-1-3-8-13/h1-5,7-10,20H,6,11-12H2/b19-16+ |
| InChIKey | IEAVZAHAJSHKOB-KNTRCKAVSA-N |
| XLogP | 5.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|